CAS 1185300-51-9

4-Piperidinemethanamine, 1-cyclopentyl-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, 1-cyclopentyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. The presence of the cyclopentyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its molecular structure suggests potential interactions with neurotransmitter systems, although specific pharmacological data would be necessary to elucidate its activity. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and industrial settings. Overall, 4-Piperidinemethanamine, 1-cyclopentyl-, hydrochloride (1:2) represents a compound of interest in the field of organic and medicinal chemistry.

Formula: C₁₁H₂₂N₂·2ClH

InChI: InChI=1S/C11H22N2.2ClH/c12-9-10-5-7-13(8-6-10)11-3-1-2-4-11;;/h10-11H,1-9,12H2;2*1H

InChI key: InChIKey=JKDJKVNTUWIHAI-UHFFFAOYSA-N

SMILES: C(N)C1CCN(CC1)C2CCCC2.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-cyclopentyl-, hydrochloride (1:2)

C-(1-Cyclopentyl-piperidin-4-yl)-methylaminedihydrochloride

CAS: 1185300-51-9

Versatile small molecule scaffold

Formula: C₁₁H₂₄Cl₂N₂

Purity: Min. 95%

Molecular weight: 255.22 g/mol

Ref: 3D-KXB30051