
CAS 1185300-53-1
:1H-Benzimidazol-6-amine, 2-(phenylmethyl)-, hydrochloride (1:2)
Description:
1H-Benzimidazol-6-amine, 2-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an amine group at the 6-position and a phenylmethyl substituent at the 2-position, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, which can enhance its bioavailability in pharmaceutical applications. The presence of the amine group suggests potential for hydrogen bonding, influencing its interactions in biological systems. This compound may exhibit properties relevant to medicinal chemistry, including potential antimicrobial or anticancer activities, although specific biological effects would require empirical investigation. Its CAS number, 1185300-53-1, allows for precise identification in chemical databases, facilitating research and development in various fields, including drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H13N3·2ClH
InChI:InChI=1S/C14H13N3.2ClH/c15-11-6-7-12-13(9-11)17-14(16-12)8-10-4-2-1-3-5-10;;/h1-7,9H,8,15H2,(H,16,17);2*1H
InChI key:InChIKey=NODDWDFHKNIUHU-UHFFFAOYSA-N
SMILES:C(C=1NC=2C(N1)=CC(N)=CC2)C3=CC=CC=C3.Cl
Synonyms:- 1H-Benzimidazol-6-amine, 2-(phenylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.