
CAS 1185300-56-4
:1H-Pyrazole-4-methanamine, 3-(4-methoxyphenyl)-, hydrochloride (1:2)
Description:
1H-Pyrazole-4-methanamine, 3-(4-methoxyphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methanamine group at the 4-position and a para-methoxyphenyl substituent at the 3-position, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the methoxy group can influence the compound's electronic properties and biological activity, making it of interest in medicinal chemistry. The compound may exhibit various biological activities, which can be explored for therapeutic applications. Its CAS number, 1185300-56-4, allows for precise identification in chemical databases. Overall, this compound's structural features suggest potential utility in drug development, particularly in areas related to neuropharmacology or anti-inflammatory research.
Formula:C11H13N3O·2ClH
InChI:InChI=1S/C11H13N3O.2ClH/c1-15-10-4-2-8(3-5-10)11-9(6-12)7-13-14-11;;/h2-5,7H,6,12H2,1H3,(H,13,14);2*1H
InChI key:InChIKey=UPQAPXKLNLBCEO-UHFFFAOYSA-N
SMILES:C(N)C=1C(=NNC1)C2=CC=C(OC)C=C2.Cl
Synonyms:- 1H-Pyrazole-4-methanamine, 3-(4-methoxyphenyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.