CAS 1185300-59-7: 1-Piperidineacetic acid, 4-oxo-, hydrochloride (1:1)

Description:1-Piperidineacetic acid, 4-oxo-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a ketone group, contributing to its acidic and potentially reactive nature. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure allows for interactions with biological targets, which may include enzymes or receptors. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is stored and used. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula:C₇H₁₁NO₃·ClH

InChI:InChI=1S/C7H11NO3.ClH/c9-6-1-3-8(4-2-6)5-7(10)11;/h1-5H2,(H,10,11);1H

InChI key:InChIKey=ITZMBUUCNROABF-UHFFFAOYSA-N

SMILES:Cl.O=C(O)CN1CCC(=O)CC1

Synonyms:
1-Piperidineacetic acid, 4-oxo-, hydrochloride (1:1)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
(4-Oxo-piperidin-1-yl)-acetic acid hydrochloride REF: IN-DA0092AICAS: 1185300-59-7	97%	To inquire	Tue 11 Mar 25
(4-Oxo-piperidin-1-yl)-acetic acid hydrochloride REF: 10-F735879CAS: 1185300-59-7	97%	To inquire	Fri 21 Mar 25
(4-Oxo-piperidin-1-yl)-acetic acid hydrochloride REF: 3D-KXB30059CAS: 1185300-59-7	Min. 95%	To inquire	Tue 22 Apr 25