CAS 1185300-63-3

Benzenamine, 5-fluoro-2-[2-(1-piperidinyl)ethoxy]-, hydrochloride (1:2)

Description:

Benzenamine, 5-fluoro-2-[2-(1-piperidinyl)ethoxy]-, hydrochloride (1:2), with the CAS number 1185300-63-3, is a chemical compound characterized by its aromatic amine structure, which includes a fluorine substituent at the 5-position of the benzene ring. The presence of a piperidine moiety indicates potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. The ethoxy group contributes to the compound's solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the fields of medicinal chemistry and pharmacology. Its specific interactions and effects would depend on its molecular structure and the presence of functional groups, making it a subject of interest for further research in drug design and development.

Formula: C₁₃H₁₉FN₂O·2ClH

InChI: InChI=1S/C13H19FN2O.2ClH/c14-11-4-5-13(12(15)10-11)17-9-8-16-6-2-1-3-7-16;;/h4-5,10H,1-3,6-9,15H2;2*1H

InChI key: InChIKey=WWAKZDBZMRHNGO-UHFFFAOYSA-N

SMILES: O(CCN1CCCCC1)C2=C(N)C=C(F)C=C2.Cl

Synonyms:

• Benzenamine, 5-fluoro-2-[2-(1-piperidinyl)ethoxy]-, hydrochloride (1:2)