CAS 1185300-65-5

2-Furancarboxylic acid, 5-methyl-4-(1-pyrrolidinylmethyl)-, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 5-methyl-4-(1-pyrrolidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure that includes a furan ring, a carboxylic acid group, and a pyrrolidine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the hydrochloride form. The presence of the furan ring contributes to its potential reactivity and biological activity, while the pyrrolidine group may enhance its pharmacological properties. The compound's molecular structure suggests it may participate in various chemical reactions, including esterification and amidation, making it of interest in synthetic organic chemistry. Additionally, its hydrochloride form indicates that it can exist as a salt, which may influence its stability and solubility in different environments. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields, although specific applications would depend on further research and development.

Formula: C₁₁H₁₅NO₃·ClH

InChI: InChI=1S/C11H15NO3.ClH/c1-8-9(6-10(15-8)11(13)14)7-12-4-2-3-5-12;/h6H,2-5,7H2,1H3,(H,13,14);1H

InChI key: InChIKey=LDVHGZZVUUGTLB-UHFFFAOYSA-N

SMILES: C(C=1C=C(C(O)=O)OC1C)N2CCCC2.Cl

Synonyms:

• 2-Furancarboxylic acid, 5-methyl-4-(1-pyrrolidinylmethyl)-, hydrochloride (1:1)