CAS 1185300-79-1

Phenol, 2-[1-[(2-hydroxyethyl)amino]ethyl]-, ethanedioate (1:1)

Description:

Phenol, 2-[1-[(2-hydroxyethyl)amino]ethyl]-, ethanedioate (1:1), also known by its CAS number 1185300-79-1, is a chemical compound characterized by its phenolic structure combined with an aminoethyl group and an ethanedioate moiety. This compound typically exhibits properties associated with both phenols and amino acids, including potential solubility in polar solvents due to the presence of hydroxyl and amino groups. It may demonstrate biological activity, possibly acting as a ligand or a precursor in various biochemical pathways. The ethanedioate portion suggests the presence of carboxylate functionalities, which can influence its reactivity and interaction with other molecules. Additionally, the compound may exhibit moderate acidity due to the phenolic hydroxyl group, and its structure may allow for hydrogen bonding, enhancing its solubility and reactivity in aqueous environments. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals, biochemistry, and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₀H₁₅NO₂·C₂H₂O₄

InChI: InChI=1S/C10H15NO2.C2H2O4/c1-8(11-6-7-12)9-4-2-3-5-10(9)13;3-1(4)2(5)6/h2-5,8,11-13H,6-7H2,1H3;(H,3,4)(H,5,6)

InChI key: InChIKey=WTODSZOWCUXMFR-UHFFFAOYSA-N

SMILES: C(NCCO)(C)C1=C(O)C=CC=C1.C(C(O)=O)(O)=O

Synonyms:

• Phenol, 2-[1-[(2-hydroxyethyl)amino]ethyl]-, ethanedioate (1:1)