CAS 1185300-94-0

Benzenemethanamine, 4-fluoro-N-[(4-methoxyphenyl)methyl]-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-fluoro-N-[(4-methoxyphenyl)methyl]-, hydrochloride (1:1), commonly referred to as a specific type of substituted amine, is characterized by its complex molecular structure that includes a benzene ring, a methanamine group, and a fluorine substituent. The presence of the 4-fluoro group indicates that a fluorine atom is attached to the benzene ring at the para position, which can influence the compound's reactivity and biological activity. The methoxyphenyl group contributes to its hydrophobic characteristics, potentially affecting its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological properties due to its structural features, which could be relevant in medicinal chemistry. However, detailed studies would be necessary to fully understand its biological activity, toxicity, and potential therapeutic uses.

Formula: C₁₅H₁₆FNO·ClH

InChI: InChI=1S/C15H16FNO.ClH/c1-18-15-8-4-13(5-9-15)11-17-10-12-2-6-14(16)7-3-12;/h2-9,17H,10-11H2,1H3;1H

InChI key: InChIKey=DFKHPFUMFNXTQA-UHFFFAOYSA-N

SMILES: C(NCC1=CC=C(F)C=C1)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Benzenemethanamine, 4-fluoro-N-[(4-methoxyphenyl)methyl]-, hydrochloride (1:1)