CAS 1185300-99-5

Imidazo[2,1-b]thiazole-2-acetic acid, 2,3,5,6-tetrahydro-3-oxo-, hydrochloride (1:1)

Description:

Imidazo[2,1-b]thiazole-2-acetic acid, 2,3,5,6-tetrahydro-3-oxo-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes an imidazole and thiazole ring. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the imidazole moiety. It is often utilized in medicinal chemistry for its potential biological activities, including antimicrobial and anti-inflammatory effects. The hydrochloride salt form enhances its solubility in aqueous solutions, making it more suitable for pharmaceutical applications. The compound's molecular structure contributes to its reactivity and interaction with biological targets, which is of interest in drug development. Additionally, its stability and compatibility with various solvents are important for formulation purposes. As with many heterocyclic compounds, it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in research and industrial settings.

Formula: C₇H₈N₂O₃S·ClH

InChI: InChI=1S/C7H8N2O3S.ClH/c10-5(11)3-4-6(12)9-2-1-8-7(9)13-4;/h4H,1-3H2,(H,10,11);1H

InChI key: InChIKey=ZKPJPPNDLKSCLN-UHFFFAOYSA-N

SMILES: O=C1N2C(SC1CC(O)=O)=NCC2.Cl

Synonyms:

• Imidazo[2,1-b]thiazole-2-acetic acid, 2,3,5,6-tetrahydro-3-oxo-, hydrochloride (1:1)