CAS 1185301-00-1

N-[(1,1-Dimethylethoxy)carbonyl]-3-methoxy-α-methylphenylalanine

Description:

N-[(1,1-Dimethylethoxy)carbonyl]-3-methoxy-α-methylphenylalanine, with the CAS number 1185301-00-1, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a methoxy group and a dimethylethoxycarbonyl moiety, which contribute to its unique chemical properties. The compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other bioactive molecules. Its structure suggests potential for various interactions due to the presence of functional groups, which can influence solubility, reactivity, and biological activity. Additionally, the α-methyl group indicates that it may exhibit stereochemical properties that could be relevant in biological systems. As with many organic compounds, handling and storage should be conducted with care, considering potential reactivity and safety protocols. Overall, this compound exemplifies the complexity and utility of modified amino acids in chemical research and development.

Formula: C₁₆H₂₃NO₅

InChI: InChI=1S/C16H23NO5/c1-15(2,3)22-14(20)17-16(4,13(18)19)10-11-7-6-8-12(9-11)21-5/h6-9H,10H2,1-5H3,(H,17,20)(H,18,19)

InChI key: InChIKey=OIRZRJJQGUJLHQ-UHFFFAOYSA-N

SMILES: C(C(NC(OC(C)(C)C)=O)(C(O)=O)C)C1=CC(OC)=CC=C1

Synonyms:

• Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-3-methoxy-α-methyl-
• N-[(1,1-Dimethylethoxy)carbonyl]-3-methoxy-α-methylphenylalanine