
CAS 1185301-01-2
:Piperidine, 3-[(3-methyl-4-nitrophenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(3-methyl-4-nitrophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 3-substituted phenoxy group, specifically a 3-methyl-4-nitrophenoxy moiety, which contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the nitro group may impart specific reactivity and biological interactions, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential uses in drug development, particularly in targeting specific biological pathways. Additionally, the hydrochloride form can influence the compound's stability, solubility, and bioavailability, which are critical factors in pharmacological studies. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to the piperidine structure.
Formula:C13H18N2O3·ClH
InChI:InChI=1S/C13H18N2O3.ClH/c1-10-7-12(4-5-13(10)15(16)17)18-9-11-3-2-6-14-8-11;/h4-5,7,11,14H,2-3,6,8-9H2,1H3;1H
InChI key:InChIKey=BFLBDEIKZZEBTI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C=C(OCC2CCCNC2)C=C1.Cl
Synonyms:- Piperidine, 3-[(3-methyl-4-nitrophenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.