CAS 1185301-07-8

Piperidine, 3-[(4-chloro-2-cyclohexylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(4-chloro-2-cyclohexylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a substituent that includes a 4-chloro-2-cyclohexylphenoxy group, indicating the presence of a chlorine atom and a cyclohexyl group attached to a phenolic structure. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure implies it may interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₈H₂₆ClNO·ClH

InChI: InChI=1S/C18H26ClNO.ClH/c19-16-8-9-18(21-13-14-5-4-10-20-12-14)17(11-16)15-6-2-1-3-7-15;/h8-9,11,14-15,20H,1-7,10,12-13H2;1H

InChI key: InChIKey=JZTISQJPPBOJLS-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=C(C=C(Cl)C=C2)C3CCCCC3.Cl

Synonyms:

• Piperidine, 3-[(4-chloro-2-cyclohexylphenoxy)methyl]-, hydrochloride (1:1)