CymitQuimica logo

CAS 1185301-10-3

:

2-[[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]phenyl]thio]acetic acid

Description:
2-[[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]phenyl]thio]acetic acid is a chemical compound characterized by its complex structure, which includes a fluorenylmethoxycarbonyl (Fmoc) protecting group, an amino group, and a thioacetic acid moiety. The presence of the Fmoc group indicates that this compound is likely used in peptide synthesis, serving as a protective group for amino acids during the formation of peptide bonds. The thioacetic acid component suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on its specific functional groups. Its molecular structure contributes to its potential applications in medicinal chemistry and biochemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound's unique features may influence its biological activity, making it of interest for further research in drug development and related fields.
Formula:C23H19NO4S
InChI:InChI=1S/C23H19NO4S/c25-22(26)14-29-16-11-9-15(10-12-16)24-23(27)28-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21H,13-14H2,(H,24,27)(H,25,26)
InChI key:InChIKey=WMZMXQSJFVQHHR-UHFFFAOYSA-N
SMILES:C(OC(NC1=CC=C(SCC(O)=O)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • Acetic acid, 2-[[4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]phenyl]thio]-
  • 2-[[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]phenyl]thio]acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.