CAS 1185301-13-6

5-Isoxazolemethanamine, 4,5-dihydro-3-methyl-, hydrochloride (1:1)

Description:

5-Isoxazolemethanamine, 4,5-dihydro-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and properties. This substance typically appears as a white to off-white crystalline powder and is soluble in water, indicating its potential for biological activity. The presence of the hydrochloride salt form enhances its stability and solubility, making it suitable for various applications, particularly in pharmaceutical research. The compound may exhibit biological activity due to the isoxazole moiety, which is often associated with various pharmacological effects. Its molecular structure includes an amine group, which can participate in hydrogen bonding, influencing its interactions in biological systems. As with many chemical substances, safety data and handling precautions are essential, as the compound may have specific toxicity or reactivity profiles. Overall, 5-Isoxazolemethanamine, 4,5-dihydro-3-methyl-, hydrochloride is of interest in medicinal chemistry and may serve as a lead compound for further drug development.

Formula: C₅H₁₀N₂O·ClH

InChI: InChI=1S/C5H10N2O.ClH/c1-4-2-5(3-6)8-7-4;/h5H,2-3,6H2,1H3;1H

InChI key: InChIKey=UMNTWZSDXYQGMR-UHFFFAOYSA-N

SMILES: C(N)C1CC(C)=NO1.Cl

Synonyms:

• 5-Isoxazolemethanamine, 4,5-dihydro-3-methyl-, hydrochloride (1:1)

[(3-Methyl-4,5-dihydroisoxazol-5-yl)methyl]amine hydrochloride

CAS: 1185301-13-6

Formula: C₅H₁₁ClN₂O

Molecular weight: 150.6066

Ref: IN-DA0099ND