CAS 1185301-18-1

2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

Description:

2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid, commonly referred to as Fmoc-Amino acid, is a synthetic compound primarily used in peptide synthesis and drug development. This substance features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized to protect amino groups during the synthesis of peptides. The presence of the benzenebutanoic acid moiety contributes to its structural complexity and potential biological activity. The compound is typically characterized by its solid-state form, exhibiting stability under standard laboratory conditions. It is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol, but may have limited solubility in water. The Fmoc group allows for easy removal under basic conditions, facilitating the sequential addition of amino acids in peptide synthesis. Overall, this compound is significant in the field of organic chemistry and biochemistry, particularly in the development of therapeutic peptides and proteins.

Formula: C₂₅H₂₃NO₄

InChI: InChI=1S/C25H23NO4/c27-24(28)15-7-9-17-8-1-6-14-23(17)26-25(29)30-16-22-20-12-4-2-10-18(20)19-11-3-5-13-21(19)22/h1-6,8,10-14,22H,7,9,15-16H2,(H,26,29)(H,27,28)

InChI key: InChIKey=NHWVYKYXTLWCJF-UHFFFAOYSA-N

SMILES: C(OC(NC1=C(CCCC(O)=O)C=CC=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• Benzenebutanoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid