CAS 1185301-20-5

Tricyclo[3.3.1.13,7]decane-1-methanamine, N-methyl-, hydrobromide (1:1)

Description:

Tricyclo[3.3.1.1^3,7]decane-1-methanamine, N-methyl-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which consists of a tricyclic framework. This compound features a methanamine group with a methyl substitution, contributing to its amine properties. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents and making it more stable for storage and handling. The presence of the tricyclic structure often imparts interesting steric and electronic properties, which can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. As a hydrobromide, it may exhibit characteristics typical of quaternary ammonium compounds, such as being a good ionic conductor. The compound's specific applications and biological activity would depend on further studies, but its structural complexity suggests potential utility in various chemical contexts, including pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₂H₂₁N·BrH

InChI: InChI=1S/C12H21N.BrH/c1-13-8-12-5-9-2-10(6-12)4-11(3-9)7-12;/h9-11,13H,2-8H2,1H3;1H

InChI key: InChIKey=LXOINMNIUXSCPN-UHFFFAOYSA-N

SMILES: C(NC)C12CC3CC(C1)CC(C2)C3.Br

Synonyms:

• Tricyclo[3.3.1.13,7]decane-1-methanamine, N-methyl-, hydrobromide (1:1)