
CAS 1185301-22-7
:2-Propanol, 1-[[(5-methyl-2-thienyl)methyl]amino]-, hydrochloride (1:1)
Description:
2-Propanol, 1-[[(5-methyl-2-thienyl)methyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a propanol backbone and a thienyl group substituted with a methyl group. This compound features an amino group that is linked to a thienyl moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The presence of the thienyl ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular interactions, stability, and reactivity can be influenced by the functional groups present, and it may exhibit characteristics such as moderate volatility and a specific melting point range. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C9H15NOS·ClH
InChI:InChI=1S/C9H15NOS.ClH/c1-7(11)5-10-6-9-4-3-8(2)12-9;/h3-4,7,10-11H,5-6H2,1-2H3;1H
InChI key:InChIKey=XJDDCXMCNDCZLQ-UHFFFAOYSA-N
SMILES:C(NCC(C)O)C1=CC=C(C)S1.Cl
Synonyms:- 2-Propanol, 1-[[(5-methyl-2-thienyl)methyl]amino]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.