CAS 1185301-28-3

1H-Benzimidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, hydrochloride (1:2)

Description:

1H-Benzimidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. This compound features an ethanol side chain and a 4-aminophenoxy group, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a hydrochloride salt, which typically enhances solubility in water and may influence its pharmacokinetic properties. The presence of the amino group suggests potential for hydrogen bonding and reactivity, which could be relevant in medicinal chemistry. This compound may exhibit various properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure and functional groups play a crucial role in determining its reactivity, solubility, and interaction with biological targets. As with many pharmaceutical compounds, safety and efficacy would need to be evaluated through rigorous testing.

Formula: C₁₆H₁₇N₃O₂·2ClH

InChI: InChI=1S/C16H17N3O2.2ClH/c17-12-5-7-14(8-6-12)21-10-13(20)9-19-11-18-15-3-1-2-4-16(15)19;;/h1-8,11,13,20H,9-10,17H2;2*1H

InChI key: InChIKey=JJTHAJHCTOHQSU-UHFFFAOYSA-N

SMILES: C(C(COC1=CC=C(N)C=C1)O)N2C=3C(N=C2)=CC=CC3.Cl

Synonyms:

• 1H-Benzimidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, hydrochloride (1:2)