CAS 1185301-30-7

2-Furancarboxylic acid, 5-ethyl-4-(1-piperidinylmethyl)-, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 5-ethyl-4-(1-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a furan ring, a carboxylic acid functional group, and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the hydrochloride salt form. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often associated with pharmacological properties. The furan ring contributes to the compound's reactivity and may participate in various chemical reactions, including electrophilic substitutions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As with many compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in detail for any practical applications. Overall, this compound represents a blend of organic functional groups that may offer diverse chemical reactivity and potential therapeutic uses.

Formula: C₁₃H₁₉NO₃·ClH

InChI: InChI=1S/C13H19NO3.ClH/c1-2-11-10(8-12(17-11)13(15)16)9-14-6-4-3-5-7-14;/h8H,2-7,9H2,1H3,(H,15,16);1H

InChI key: InChIKey=NNAHDKRZQYLASK-UHFFFAOYSA-N

SMILES: C(C1=C(CC)OC(C(O)=O)=C1)N2CCCCC2.Cl

Synonyms:

• 2-Furancarboxylic acid, 5-ethyl-4-(1-piperidinylmethyl)-, hydrochloride (1:1)