CAS 1185301-32-9

[1,4′-Bipiperidine]-4-carboxylic acid, 1′-propyl-, hydrochloride (1:2)

Description:

[1,4′-Bipiperidine]-4-carboxylic acid, 1′-propyl-, hydrochloride (1:2) is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a propyl substituent that enhances its hydrophobic characteristics. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically improves its solubility in water and stability. The presence of the bipiperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Overall, this compound's unique structural features and functional groups make it of interest in various chemical and pharmaceutical research contexts.

Formula: C₁₄H₂₆N₂O₂·2ClH

InChI: InChI=1S/C14H26N2O2.2ClH/c1-2-7-15-8-5-13(6-9-15)16-10-3-12(4-11-16)14(17)18;;/h12-13H,2-11H2,1H3,(H,17,18);2*1H

InChI key: InChIKey=MZOOEKQDHHTYGE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCN(CC1)C2CCN(CCC)CC2.Cl

Synonyms:

• [1,4′-Bipiperidine]-4-carboxylic acid, 1′-propyl-, hydrochloride (1:2)