CAS 1185301-35-2

1,2,4-Oxadiazole-5-methanamine, 3-(phenylmethyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methanamine group attached to the oxadiazole, along with a phenylmethyl substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The presence of the phenylmethyl group may influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas related to neuropharmacology or antimicrobial activity. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₁N₃O·ClH

InChI: InChI=1S/C10H11N3O.ClH/c11-7-10-12-9(13-14-10)6-8-4-2-1-3-5-8;/h1-5H,6-7,11H2;1H

InChI key: InChIKey=KTFHPSGDFROIQL-UHFFFAOYSA-N

SMILES: C(C=1N=C(CN)ON1)C2=CC=CC=C2.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-(phenylmethyl)-, hydrochloride (1:1)