CAS 1185301-38-5

Piperidine, 3-(cyclopropylmethoxy)-, hydrochloride (1:1)

Description:

Piperidine, 3-(cyclopropylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclopropylmethoxy group at the 3-position of the piperidine ring contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in hydrogen bonding due to the presence of the methoxy group. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific pharmacological effects, toxicity, and other characteristics would require further investigation through empirical studies. Overall, this compound represents a class of piperidine derivatives that may have significant implications in drug development and synthesis.

Formula: C₉H₁₇NO·ClH

InChI: InChI=1S/C9H17NO.ClH/c1-2-9(6-10-5-1)11-7-8-3-4-8;/h8-10H,1-7H2;1H

InChI key: InChIKey=ONFORIIOCLAQSK-UHFFFAOYSA-N

SMILES: O(CC1CC1)C2CCCNC2.Cl

Synonyms:

• 3-(Cyclopropylmethoxy)piperidine hydrochloride
• Piperidine, 3-(cyclopropylmethoxy)-, hydrochloride (1:1)