CAS 1185301-39-6
:Piperidine, 3-[(4-methylphenyl)methoxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(4-methylphenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a methoxy group attached to a 4-methylphenyl moiety indicates that this compound has both aromatic and aliphatic characteristics, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with neurotransmitter systems, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.
Formula:C13H19NO·ClH
InChI:InChI=1S/C13H19NO.ClH/c1-11-4-6-12(7-5-11)10-15-13-3-2-8-14-9-13;/h4-7,13-14H,2-3,8-10H2,1H3;1H
InChI key:InChIKey=CGTYNFFAURNDLS-UHFFFAOYSA-N
SMILES:C(OC1CCCNC1)C2=CC=C(C)C=C2.Cl
Synonyms:- Piperidine, 3-[(4-methylphenyl)methoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
