CymitQuimica logo

CAS 1185301-60-3

:

Piperidine, 4-[(6-bromo-2-naphthalenyl)oxy]-, hydrochloride (1:1)

Description:
Piperidine, 4-[(6-bromo-2-naphthalenyl)oxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a 6-bromo-2-naphthalenyl group indicates that the compound has a naphthalene ring substituted with a bromine atom, contributing to its aromatic properties and potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties due to the combination of the piperidine structure and the naphthalene moiety, making it of interest in medicinal chemistry. Its molecular interactions, stability, and potential toxicity would depend on the specific functional groups and their arrangement within the molecule. Overall, this compound represents a unique combination of structural features that may confer interesting chemical and biological properties.
Formula:C15H16BrNO·ClH
InChI:InChI=1S/C15H16BrNO.ClH/c16-13-3-1-12-10-15(4-2-11(12)9-13)18-14-5-7-17-8-6-14;/h1-4,9-10,14,17H,5-8H2;1H
InChI key:InChIKey=WYFNVGVWDOWKNC-UHFFFAOYSA-N
SMILES:O(C1=CC2=C(C=C1)C=C(Br)C=C2)C3CCNCC3.Cl
Synonyms:
  • Piperidine, 4-[(6-bromo-2-naphthalenyl)oxy]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.