CAS 1185301-62-5

Thiourea, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:

Thiourea, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its thiourea backbone, which is modified by the presence of a 2,4-dichlorophenylmethyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its hydrochloride form. The presence of the dichlorophenyl group suggests potential applications in pharmaceuticals or agrochemicals, as such substituents often enhance biological activity or selectivity. The hydrochloride form indicates that the compound is a salt, which can influence its stability and solubility properties. In terms of safety, thiourea derivatives can exhibit toxicity, and appropriate handling precautions should be taken. The compound's CAS number, 1185301-62-5, allows for precise identification in chemical databases and literature. Overall, this substance may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential reactivity.

Formula: C₈H₈Cl₂N₂S·ClH

InChI: InChI=1S/C8H8Cl2N2S.ClH/c9-6-2-1-5(7(10)3-6)4-12-8(11)13;/h1-3H,4H2,(H3,11,12,13);1H

InChI key: InChIKey=XQQQQSWPYSTFNH-UHFFFAOYSA-N

SMILES: C(NC(N)=S)C1=C(Cl)C=C(Cl)C=C1.Cl

Synonyms:

• Thiourea, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)