
CAS 1185301-78-3
:Pyrrolidine, 3-(2,5-dimethylphenoxy)-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-(2,5-dimethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,5-dimethylphenoxy group indicates that the compound has a phenolic structure with two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its molecular properties, such as melting point, boiling point, and solubility, would be influenced by the presence of the hydrochloride group. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in medicinal chemistry.
Formula:C12H17NO·ClH
InChI:InChI=1S/C12H17NO.ClH/c1-9-3-4-10(2)12(7-9)14-11-5-6-13-8-11;/h3-4,7,11,13H,5-6,8H2,1-2H3;1H
InChI key:InChIKey=GRHZWRPKCDTZRP-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=CC(C)=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-(2,5-dimethylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.