CymitQuimica logo

CAS 1185301-81-8

:

8-Azabicyclo[3.2.1]octan-3-amine, N,N-dimethyl-, hydrochloride (1:2)

Description:
8-Azabicyclo[3.2.1]octan-3-amine, N,N-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system, contributing to its classification as a bicyclic amine. The presence of the dimethyl group indicates that the amine is tertiary, which can influence its basicity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. The compound may exhibit biological activity, potentially interacting with neurotransmitter systems, which is common for compounds with similar structures. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C9H18N2·2ClH
InChI:InChI=1S/C9H18N2.2ClH/c1-11(2)9-5-7-3-4-8(6-9)10-7;;/h7-10H,3-6H2,1-2H3;2*1H
InChI key:InChIKey=GUQIZKQJDQKHRJ-UHFFFAOYSA-N
SMILES:N(C)(C)C1CC2NC(C1)CC2.Cl
Synonyms:
  • 8-Azabicyclo[3.2.1]octan-3-amine, N,N-dimethyl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.