CymitQuimica logo

CAS 1185301-82-9

:

3-Pyridinecarbonitrile, 2-(4-amino-1-piperidinyl)-, hydrochloride (1:2)

Description:
3-Pyridinecarbonitrile, 2-(4-amino-1-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity. The presence of a cyano group (nitrile) on the pyridine ring enhances its reactivity and potential for forming various derivatives. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, and it may interact with biological targets due to the amino group on the piperidine ring, which can participate in hydrogen bonding and other interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting neurological or psychiatric disorders. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through experimental studies.
Formula:C11H14N4·2ClH
InChI:InChI=1S/C11H14N4.2ClH/c12-8-9-2-1-5-14-11(9)15-6-3-10(13)4-7-15;;/h1-2,5,10H,3-4,6-7,13H2;2*1H
InChI key:InChIKey=RCLXJRPPISPFAA-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=CC=C1)N2CCC(N)CC2.Cl
Synonyms:
  • 3-Pyridinecarbonitrile, 2-(4-amino-1-piperidinyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.