CAS 1185301-83-0

Pyrrolidine, 3-(2-ethoxyphenoxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(2-ethoxyphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of the 2-ethoxyphenoxy group indicates that it has an ether functional group attached to a phenolic structure, contributing to its potential solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit biological activity due to the presence of both the pyrrolidine and phenoxy moieties, which are often associated with various pharmacological effects. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₂H₁₇NO₂·ClH

InChI: InChI=1S/C12H17NO2.ClH/c1-2-14-11-5-3-4-6-12(11)15-10-7-8-13-9-10;/h3-6,10,13H,2,7-9H2,1H3;1H

InChI key: InChIKey=ZKSUXLSUJAWPTL-UHFFFAOYSA-N

SMILES: O(C1=C(OCC)C=CC=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(2-ethoxyphenoxy)-, hydrochloride (1:1)

3-(2-Ethoxyphenoxy)pyrrolidine hydrochloride

CAS: 1185301-83-0

Versatile small molecule scaffold

Formula: C₁₂H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 243.73 g/mol

Ref: 3D-KXB30183