CAS 1185301-84-1

3-Pyrrolidinecarboxamide, N-[2-(3-methyl-1H-pyrazol-1-yl)ethyl]-, hydrochloride (1:2)

Description:

3-Pyrrolidinecarboxamide, N-[2-(3-methyl-1H-pyrazol-1-yl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a pyrazole moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is beneficial for various applications, particularly in pharmaceutical contexts. The presence of the pyrazole ring suggests potential biological activity, as pyrazoles are often associated with diverse pharmacological properties. The compound's molecular structure indicates it may interact with biological targets, making it of interest in medicinal chemistry. Its characteristics, such as melting point, solubility, and stability, can vary based on the specific formulation and conditions. As with many organic compounds, safety and handling precautions are essential, particularly when dealing with hydrochloride salts, which can be hygroscopic and may require specific storage conditions to maintain integrity. Overall, this compound represents a class of substances that may have significant implications in drug development and therapeutic applications.

Formula: C₁₁H₁₈N₄O·2ClH

InChI: InChI=1S/C11H18N4O.2ClH/c1-9-3-6-15(14-9)7-5-13-11(16)10-2-4-12-8-10;;/h3,6,10,12H,2,4-5,7-8H2,1H3,(H,13,16);2*1H

InChI key: InChIKey=FPUXZRMDDXTWNJ-UHFFFAOYSA-N

SMILES: C(NCCN1N=C(C)C=C1)(=O)C2CCNC2.Cl

Synonyms:

• 3-Pyrrolidinecarboxamide, N-[2-(3-methyl-1H-pyrazol-1-yl)ethyl]-, hydrochloride (1:2)