CAS 1185302-11-7

Hexanoic acid, 6-[(1,4,5,6-tetrahydro-4,6-dioxo-2-pyrimidinyl)amino]-, 2,2,2-trifluoroacetate (1:1)

Description:

Hexanoic acid, 6-[(1,4,5,6-tetrahydro-4,6-dioxo-2-pyrimidinyl)amino]-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its complex structure, which includes a hexanoic acid moiety and a pyrimidine derivative. The presence of the trifluoroacetate group suggests that the compound may exhibit unique solubility and reactivity properties, particularly in polar solvents. The tetrahydro-pyrimidine ring contributes to the compound's potential biological activity, possibly influencing its interaction with biological systems. This compound may be of interest in pharmaceutical research due to its potential as a drug candidate or as a biochemical tool. Its molecular structure indicates that it could participate in hydrogen bonding and other intermolecular interactions, which are critical for its behavior in various chemical environments. Additionally, the presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of organic compounds, potentially affecting its pharmacokinetic properties. Overall, this compound represents a unique combination of functional groups that may confer specific chemical and biological characteristics.

Formula: C₁₀H₁₅N₃O₄·C₂HF₃O₂

InChI: InChI=1S/C10H15N3O4.C2HF3O2/c14-7-6-8(15)13-10(12-7)11-5-3-1-2-4-9(16)17;3-2(4,5)1(6)7/h1-6H2,(H,16,17)(H2,11,12,13,14,15);(H,6,7)

InChI key: InChIKey=FKXMDPLRKTYUAC-UHFFFAOYSA-N

SMILES: N(CCCCCC(O)=O)C=1NC(=O)CC(=O)N1.C(C(O)=O)(F)(F)F

Synonyms:

• Hexanoic acid, 6-[(1,4,5,6-tetrahydro-4,6-dioxo-2-pyrimidinyl)amino]-, 2,2,2-trifluoroacetate (1:1)

6-(4,6-Dioxo-1,4,5,6-tetrahydropyrimidin-2-yl-amino)hexanoic Acid Trifluoroacetate

Controlled Product

CAS: 1185302-11-7

Applications 6-(4,6-Dioxo-1,4,5,6-tetrahydropyrimidin-2-yl-amino)hexanoicacidtrifluoroacetate (cas# 1185302-11-7) is a useful research chemical.

Formula: C₁₀H₁₅N₃O₄·C₂HF₃O₂

Color and Shape: Neat

Molecular weight: 355.267

Ref: TR-D487168