
CAS 1185302-18-4
:Benzenamine, N-2-butyn-1-yl-, hydrochloride (1:1)
Description:
Benzenamine, N-2-butyn-1-yl-, hydrochloride (1:1), also known as 2-butyn-1-yl aniline hydrochloride, is an organic compound characterized by its amine functional group attached to a benzene ring and a butynyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the butynyl group introduces a degree of unsaturation and can influence the compound's reactivity, making it potentially useful in various chemical syntheses or as an intermediate in organic reactions. Its amine functionality allows for hydrogen bonding, which can affect its physical properties and interactions with other molecules. Safety data should be consulted, as amines can be hazardous, and appropriate handling procedures should be followed. Overall, this compound is of interest in both academic and industrial chemistry for its unique structural features and potential applications.
Formula:C10H11N·ClH
InChI:InChI=1S/C10H11N.ClH/c1-2-3-9-11-10-7-5-4-6-8-10;/h4-8,11H,9H2,1H3;1H
InChI key:InChIKey=MCMWIUYBLVPFRZ-UHFFFAOYSA-N
SMILES:N(CC#CC)C1=CC=CC=C1.Cl
Synonyms:- Benzenamine, N-2-butyn-1-yl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.