
CAS 1185302-30-0
:3-Pyridinemethanamine, N-cyclopentyl-, hydrochloride (1:2)
Description:
3-Pyridinemethanamine, N-cyclopentyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and amine functional groups, which contribute to its basicity and potential reactivity. The presence of the cyclopentyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting specific receptors or pathways. Its molecular structure suggests potential interactions with biological systems, and it may be studied for its effects on neurotransmitter systems or other physiological processes. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 3-Pyridinemethanamine, N-cyclopentyl-, hydrochloride (1:2) represents a class of compounds with diverse applications in research and industry.
Formula:C11H16N2·2ClH
InChI:InChI=1S/C11H16N2.2ClH/c1-2-6-11(5-1)13-9-10-4-3-7-12-8-10;;/h3-4,7-8,11,13H,1-2,5-6,9H2;2*1H
InChI key:InChIKey=YNTANOPPCLUEMD-UHFFFAOYSA-N
SMILES:C(NC1CCCC1)C=2C=CC=NC2.Cl
Synonyms:- 3-Pyridinemethanamine, N-cyclopentyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.