CAS 1185302-45-7

Benzamide, N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]-, hydrochloride (1:1)

Description:

Benzamide, N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzamide moiety and a tetrahydro-pyrazolo-pyridine derivative. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The presence of the tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridine group suggests potential biological activity, possibly related to central nervous system effects or other pharmacological properties. The hydrochloride form enhances its stability and solubility, making it suitable for various applications in medicinal chemistry and drug formulation. As with many compounds of this nature, safety data should be consulted to understand its toxicity and handling requirements. Overall, this compound represents a unique combination of structural features that may contribute to its potential therapeutic effects.

Formula: C₂₁H₂₂N₄O·ClH

InChI: InChI=1S/C21H22N4O.ClH/c1-24-20-12-13-22-14-18(20)19(23-24)15-25(17-10-6-3-7-11-17)21(26)16-8-4-2-5-9-16;/h2-11,22H,12-15H2,1H3;1H

InChI key: InChIKey=MGYGEXPFIZTVLU-UHFFFAOYSA-N

SMILES: C(N(C(=O)C1=CC=CC=C1)C2=CC=CC=C2)C=3C4=C(N(C)N3)CCNC4.Cl

Synonyms:

• Benzamide, N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]-, hydrochloride (1:1)