CAS 1185302-51-5

1H-Indole-2-ethanamine, 1,5-dimethyl-, hydrochloride (1:1)

Description:

1H-Indole-2-ethanamine, 1,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a dimethyl substitution at the 1 and 5 positions of the indole ring, along with an ethylamine side chain at the 2 position. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. Typically, compounds of this nature may exhibit biological activity, potentially influencing neurotransmitter systems, and could be of interest in pharmacological research. The presence of the indole moiety often suggests potential interactions with serotonin receptors, which are significant in various physiological processes. As with many amines, the compound may also display basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed due to its potential biological activity.

Formula: C₁₂H₁₆N₂·ClH

InChI: InChI=1S/C12H16N2.ClH/c1-9-3-4-12-10(7-9)8-11(5-6-13)14(12)2;/h3-4,7-8H,5-6,13H2,1-2H3;1H

InChI key: InChIKey=MTTONFDJKWINJL-UHFFFAOYSA-N

SMILES: CN1C=2C(C=C1CCN)=CC(C)=CC2.Cl

Synonyms:

• 1H-Indole-2-ethanamine, 1,5-dimethyl-, hydrochloride (1:1)