CAS 1185302-52-6

Benzenamine, 2-methyl-4-(3-pyridinyloxy)-, hydrochloride (1:2)

Description:

Benzenamine, 2-methyl-4-(3-pyridinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with an amino group and a pyridinyloxy moiety. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. This compound typically exhibits properties associated with both amines and aromatic compounds, such as potential basicity and the ability to participate in hydrogen bonding. The pyridinyloxy group may contribute to its biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the presence of the methyl group and the pyridine ring, which may affect its reactivity and stability. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks depending on exposure levels. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and material science.

Formula: C₁₂H₁₂N₂O·2ClH

InChI: InChI=1S/C12H12N2O.2ClH/c1-9-7-10(4-5-12(9)13)15-11-3-2-6-14-8-11;;/h2-8H,13H2,1H3;2*1H

InChI key: InChIKey=QAWGGQJYVWLOCI-UHFFFAOYSA-N

SMILES: O(C1=CC(C)=C(N)C=C1)C=2C=CC=NC2.Cl

Synonyms:

• Benzenamine, 2-methyl-4-(3-pyridinyloxy)-, hydrochloride (1:2)