CAS 1185302-63-9

Benzenamine, 5-fluoro-2-(3-methyl-1-piperidinyl)-, hydrochloride (1:2)

Description:

Benzenamine, 5-fluoro-2-(3-methyl-1-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its aromatic amine structure, which includes a fluorine substituent at the 5-position of the benzene ring and a piperidine moiety. The presence of the piperidine ring, specifically the 3-methyl substitution, contributes to its potential biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as basicity due to the amine group, and its fluorine atom can influence lipophilicity and metabolic stability. Its molecular interactions may be relevant in drug design, particularly in targeting specific receptors or enzymes. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and applications.

Formula: C₁₂H₁₇FN₂·2ClH

InChI: InChI=1S/C12H17FN2.2ClH/c1-9-3-2-6-15(8-9)12-5-4-10(13)7-11(12)14;;/h4-5,7,9H,2-3,6,8,14H2,1H3;2*1H

InChI key: InChIKey=JKFQASJMRHODEO-UHFFFAOYSA-N

SMILES: NC1=C(N2CC(C)CCC2)C=CC(F)=C1.Cl

Synonyms:

• Benzenamine, 5-fluoro-2-(3-methyl-1-piperidinyl)-, hydrochloride (1:2)