CAS 1185302-69-5

1,4-Benzoxazepine, 7-[[(2-chlorophenyl)methoxy]methyl]-2,3,4,5-tetrahydro-, hydrochloride (1:1)

Description:

1,4-Benzoxazepine, 7-[[(2-chlorophenyl)methoxy]methyl]-2,3,4,5-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a benzoxazepine core. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a methoxy group attached to a chlorophenyl moiety, which contributes to its unique chemical properties. The hydrochloride salt form suggests that it is a protonated version of the base compound, enhancing its solubility in water and potentially influencing its pharmacological activity. The presence of the chlorine atom in the chlorophenyl group may impart specific electronic and steric effects, which can affect the compound's reactivity and biological interactions. This substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many benzoxazepines, it may exhibit a range of biological activities, although specific applications would depend on further research and characterization.

Formula: C₁₇H₁₈ClNO₂·ClH

InChI: InChI=1S/C17H18ClNO2.ClH/c18-16-4-2-1-3-14(16)12-20-11-13-5-6-17-15(9-13)10-19-7-8-21-17;/h1-6,9,19H,7-8,10-12H2;1H

InChI key: InChIKey=DRROFYXEPZREMH-UHFFFAOYSA-N

SMILES: C(OCC1=C(Cl)C=CC=C1)C=2C=C3C(=CC2)OCCNC3.Cl

Synonyms:

• 1,4-Benzoxazepine, 7-[[(2-chlorophenyl)methoxy]methyl]-2,3,4,5-tetrahydro-, hydrochloride (1:1)