CAS 1185302-77-5

Piperidine, 3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the 1,2,4-oxadiazole moiety introduces unique properties, including potential biological activity, as oxadiazoles are often associated with pharmacological effects. The compound exists as a hydrochloride salt, which enhances its solubility in water and may influence its stability and bioavailability. Typically, such compounds are studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of the 2-methylpropyl group may contribute to the lipophilicity of the molecule, affecting its pharmacokinetic properties. As with any chemical substance, safety data and handling precautions should be considered, especially in laboratory settings.

Formula: C₁₁H₁₉N₃O·ClH

InChI: InChI=1S/C11H19N3O.ClH/c1-8(2)6-10-13-11(15-14-10)9-4-3-5-12-7-9;/h8-9,12H,3-7H2,1-2H3;1H

InChI key: InChIKey=DUQKNTQHRKQHRO-UHFFFAOYSA-N

SMILES: C(C(C)C)C=1N=C(ON1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)