CAS 1185302-78-6
:2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,4-dimethylbenzoic acid
Description:
2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,4-dimethylbenzoic acid, commonly referred to as a fluorene-derived compound, is characterized by its complex structure that includes a fluorene moiety, an amine group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its stability and reactivity. The presence of the fluorene group imparts significant hydrophobic characteristics, while the carboxylic acid group provides acidity and potential for hydrogen bonding. The dimethyl substitution on the benzene ring enhances steric hindrance, which can influence its reactivity and interactions with other molecules. This compound is often utilized in organic synthesis and medicinal chemistry, particularly in the development of peptide-based drugs or as a protecting group in various chemical reactions. Its solubility and behavior in different solvents can vary, making it important to consider the solvent environment in experimental applications. Overall, this compound exemplifies the intricate balance of hydrophobic and hydrophilic properties typical of many organic molecules used in advanced chemical research.
Formula:C24H21NO4
InChI:InChI=1S/C24H21NO4/c1-14-11-12-20(23(26)27)22(15(14)2)25-24(28)29-13-21-18-9-5-3-7-16(18)17-8-4-6-10-19(17)21/h3-12,21H,13H2,1-2H3,(H,25,28)(H,26,27)
InChI key:InChIKey=MCVBWDCTVPZBHP-UHFFFAOYSA-N
SMILES:C(OC(NC1=C(C(O)=O)C=CC(C)=C1C)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- Benzoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3,4-dimethyl-
- 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3,4-dimethylbenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.