CymitQuimica logo

CAS 1185302-79-7

:

Piperidine, 3-(4-chloro-3,5-dimethylphenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 3-(4-chloro-3,5-dimethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 4-chloro-3,5-dimethylphenoxy group indicates that it has a phenolic structure with chlorine and methyl substituents, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a precursor in synthetic pathways. Its molecular structure suggests it could interact with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the context of drug development and chemical synthesis.
Formula:C13H18ClNO·ClH
InChI:InChI=1S/C13H18ClNO.ClH/c1-9-6-12(7-10(2)13(9)14)16-11-4-3-5-15-8-11;/h6-7,11,15H,3-5,8H2,1-2H3;1H
InChI key:InChIKey=MXVWGCXBVGEJPL-UHFFFAOYSA-N
SMILES:O(C1=CC(C)=C(Cl)C(C)=C1)C2CCCNC2.Cl
Synonyms:
  • Piperidine, 3-(4-chloro-3,5-dimethylphenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.