
CAS 1185302-97-9
:4-(5-Pyrimidinyl)-2-morpholinecarboxylic acid
Description:
4-(5-Pyrimidinyl)-2-morpholinecarboxylic acid, identified by its CAS number 1185302-97-9, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a morpholine moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the pyrimidine ring suggests possible interactions with biological targets, while the morpholine structure may contribute to its solubility and stability in biological systems. The carboxylic acid group can participate in hydrogen bonding and may influence the compound's acidity and reactivity. Overall, this compound's characteristics, including its molecular weight, solubility, and potential biological activity, make it a subject of interest for further research, particularly in the development of pharmaceuticals or agrochemicals. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise values.
Formula:C9H11N3O3
InChI:InChI=1S/C9H11N3O3/c13-9(14)8-5-12(1-2-15-8)7-3-10-6-11-4-7/h3-4,6,8H,1-2,5H2,(H,13,14)
InChI key:InChIKey=OQWAZEZVAGPQHZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(CCO1)C=2C=NC=NC2
Synonyms:- 4-(5-Pyrimidinyl)-2-morpholinecarboxylic acid
- 2-Morpholinecarboxylic acid, 4-(5-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
