CAS 1185303-08-5

3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexanedioic acid

Description:

3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexanedioic acid, commonly referred to as Fmoc-hexanedioic acid, is a chemical compound characterized by its structure, which includes a hexanedioic acid backbone modified with a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is primarily used in peptide synthesis as a protective group for amino acids, allowing for selective reactions without interfering with other functional groups. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in multi-step synthesis. The presence of the hexanedioic acid moiety provides additional functional sites for further chemical modifications. This compound is typically a white to off-white solid and is soluble in organic solvents, which facilitates its use in various synthetic applications. Its unique structure and properties make it a valuable intermediate in the field of organic chemistry and biochemistry, particularly in the development of peptide-based therapeutics.

Formula: C₂₁H₂₁NO₆

InChI: InChI=1S/C21H21NO6/c23-19(24)10-9-13(11-20(25)26)22-21(27)28-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12H2,(H,22,27)(H,23,24)(H,25,26)

InChI key: InChIKey=JJSUQIKTDAOMSC-UHFFFAOYSA-N

SMILES: C(OC(NC(CCC(O)=O)CC(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2

Synonyms:

• Hexanedioic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• 3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexanedioic acid