CAS 1185303-18-7
:2-[[4-[[(1,1-Dimethylethoxy)carbonyl]amino]phenyl]amino]-2-oxoacetic acid
Description:
2-[[4-[[(1,1-Dimethylethoxy)carbonyl]amino]phenyl]amino]-2-oxoacetic acid, with the CAS number 1185303-18-7, is a chemical compound characterized by its complex structure, which includes an amino acid derivative and a dimethylethoxycarbonyl group. This compound typically exhibits properties associated with both amino acids and carboxylic acids, such as the ability to form hydrogen bonds and participate in various chemical reactions. It is likely to be soluble in polar solvents due to the presence of functional groups that can engage in dipole-dipole interactions. The dimethylethoxycarbonyl moiety may enhance its stability and influence its reactivity, making it a potential candidate for applications in pharmaceuticals or biochemistry. Additionally, the presence of multiple functional groups suggests that it may exhibit diverse biological activities, which could be of interest in drug development or as a biochemical probe. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological contexts.
Formula:C13H16N2O5
InChI:InChI=1S/C13H16N2O5/c1-13(2,3)20-12(19)15-9-6-4-8(5-7-9)14-10(16)11(17)18/h4-7H,1-3H3,(H,14,16)(H,15,19)(H,17,18)
InChI key:InChIKey=QABHBMHRTNUBPB-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)=O)C1=CC=C(NC(OC(C)(C)C)=O)C=C1
Synonyms:- Acetic acid, 2-[[4-[[(1,1-dimethylethoxy)carbonyl]amino]phenyl]amino]-2-oxo-
- 2-[[4-[[(1,1-Dimethylethoxy)carbonyl]amino]phenyl]amino]-2-oxoacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.