
CAS 1185303-24-5
:2-Propanol, 1-amino-3-[(2-phenylethyl)amino]-, hydrochloride (1:2)
Description:
2-Propanol, 1-amino-3-[(2-phenylethyl)amino]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a propanol backbone with amino groups and a phenylethyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of amino groups suggests potential basicity and reactivity, making it relevant in various biochemical applications, including drug development and synthesis. The phenylethyl moiety may contribute to its biological activity, possibly influencing interactions with biological targets. As a hydrochloride, it is likely to exhibit properties typical of amine salts, such as increased solubility in polar solvents. The compound's molecular structure indicates potential for hydrogen bonding, which can affect its physical properties, such as melting point and boiling point. Overall, this substance may be of interest in medicinal chemistry and pharmacology due to its unique functional groups and potential therapeutic applications.
Formula:C11H18N2O·2ClH
InChI:InChI=1S/C11H18N2O.2ClH/c12-8-11(14)9-13-7-6-10-4-2-1-3-5-10;;/h1-5,11,13-14H,6-9,12H2;2*1H
InChI key:InChIKey=OVUOSBGAQAYRBA-UHFFFAOYSA-N
SMILES:C(CNCC(CN)O)C1=CC=CC=C1.Cl
Synonyms:- 2-Propanol, 1-amino-3-[(2-phenylethyl)amino]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.