CymitQuimica logo

CAS 1185303-30-3

:

Benzenemethanamine, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:2)

Description:
Benzenemethanamine, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a benzene ring and a pyrazole moiety. This compound typically exists as a hydrochloride salt, indicating that it is protonated and forms a stable ionic compound with hydrochloric acid. The presence of the pyrazole group suggests potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The compound may exhibit properties such as solubility in polar solvents due to its ionic nature, and it may participate in various chemical reactions typical of amines and aromatic compounds. Its molecular interactions could be influenced by the functional groups present, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with many amine-containing compounds, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific applications and biological effects.
Formula:C10H11N3·2ClH
InChI:InChI=1S/C10H11N3.2ClH/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13;;/h1-7H,8,11H2;2*1H
InChI key:InChIKey=QMJUCGGTHLKCQZ-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(C=C1)N2C=CC=N2.Cl
Synonyms:
  • Benzenemethanamine, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.