CAS 1185303-34-7

Methanone, 1-piperazinyl-4-pyridinyl-, hydrochloride (1:3)

Description:

Methanone, 1-piperazinyl-4-pyridinyl-, hydrochloride (1:3), with the CAS number 1185303-34-7, is a chemical compound characterized by its unique structure that includes a piperazine moiety and a pyridine ring. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in medicinal chemistry. The presence of the piperazine group often contributes to its pharmacological properties, potentially influencing its interaction with biological targets. Methanone derivatives are known for their roles in drug development, particularly in the fields of neuropharmacology and anti-infective agents. The hydrochloride form indicates that it is a protonated species, which can affect its stability and bioavailability. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific biological effects and safety profile can vary based on concentration and exposure routes. Overall, this compound represents a significant interest in research and development within the pharmaceutical industry.

Formula: C₁₀H₁₃N₃O.3ClH

InChI: InChI=1S/C10H13N3O.3ClH/c14-10(9-1-3-11-4-2-9)13-7-5-12-6-8-13;;;/h1-4,12H,5-8H2;3*1H

InChI key: InChIKey=ZJXZTYXVNXVWJK-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=CN=CC1)N2CCNCC2.Cl