CAS 1185303-43-8

1-Pyrrolidineethanamine, β-(4-chlorophenyl)-, ethanedioate (1:1)

Description:

1-Pyrrolidineethanamine, β-(4-chlorophenyl)-, ethanedioate (1:1), identified by its CAS number 1185303-43-8, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and an ethanamine moiety, along with a β-(4-chlorophenyl) substituent. This compound typically exhibits properties associated with both amines and carboxylic acids due to the presence of the ethanedioate (oxalic acid) component. It may display moderate solubility in polar solvents, influenced by its functional groups, and can participate in various chemical reactions, including nucleophilic substitutions and acid-base interactions. The presence of the 4-chlorophenyl group may impart specific biological activities or interactions, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other reagents. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₇ClN₂·C₂H₂O₄

InChI: InChI=1S/C12H17ClN2.C2H2O4/c13-11-5-3-10(4-6-11)12(9-14)15-7-1-2-8-15;3-1(4)2(5)6/h3-6,12H,1-2,7-9,14H2;(H,3,4)(H,5,6)

InChI key: InChIKey=WOWFWJZCMDEOEX-UHFFFAOYSA-N

SMILES: C(CN)(C1=CC=C(Cl)C=C1)N2CCCC2.C(C(O)=O)(O)=O

Synonyms:

• 1-Pyrrolidineethanamine, β-(4-chlorophenyl)-, ethanedioate (1:1)