
CAS 1185303-49-4
:1-Phthalazinepropanamide, N-(2-aminoethyl)-3,4-dihydro-4-oxo-, hydrochloride (1:1)
Description:
1-Phthalazinepropanamide, N-(2-aminoethyl)-3,4-dihydro-4-oxo-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a phthalazine moiety and an amide functional group. This compound typically exhibits properties associated with both amides and heterocycles, such as moderate solubility in polar solvents and potential biological activity due to its amine and carbonyl functionalities. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility in aqueous solutions. The presence of the aminoethyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns typical of amides and heterocycles, such as nucleophilic substitution or hydrogen bonding. Its application may extend to pharmaceutical research, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties, including its pharmacokinetics, toxicity, and mechanism of action.
Formula:C13H16N4O2·ClH
InChI:InChI=1S/C13H16N4O2.ClH/c14-7-8-15-12(18)6-5-11-9-3-1-2-4-10(9)13(19)17-16-11;/h1-4H,5-8,14H2,(H,15,18)(H,17,19);1H
InChI key:InChIKey=FXEULELPANDMCE-UHFFFAOYSA-N
SMILES:C(CC(NCCN)=O)C=1C=2C(C(=O)NN1)=CC=CC2.Cl
Synonyms:- 1-Phthalazinepropanamide, N-(2-aminoethyl)-3,4-dihydro-4-oxo-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.