CAS 1185303-58-5

Acetamide, 2-chloro-N-[3,5-dimethyl-1-(phenylmethyl)-1H-pyrazol-4-yl]-, hydrochloride (1:1)

Description:

Acetamide, 2-chloro-N-[3,5-dimethyl-1-(phenylmethyl)-1H-pyrazol-4-yl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes an acetamide functional group and a chloro substituent. The presence of a pyrazole ring, substituted with both methyl and phenylmethyl groups, contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the chloro group and the steric effects of the methyl and phenylmethyl substituents. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specialized class of organic molecules with potential applications in drug development and research.

Formula: C₁₄H₁₆ClN₃O·ClH

InChI: InChI=1S/C14H16ClN3O.ClH/c1-10-14(16-13(19)8-15)11(2)18(17-10)9-12-6-4-3-5-7-12;/h3-7H,8-9H2,1-2H3,(H,16,19);1H

InChI key: InChIKey=OJQDNMJRQJBARP-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=C(C)N(CC2=CC=CC=C2)N=C1C.Cl

Synonyms:

• Acetamide, 2-chloro-N-[3,5-dimethyl-1-(phenylmethyl)-1H-pyrazol-4-yl]-, hydrochloride (1:1)